Tigloidin
Modify Date: 2025-08-27 11:33:18
Tigloidin structure
|
Common Name | Tigloidin | ||
|---|---|---|---|---|
| CAS Number | 495-83-0 | Molecular Weight | 223.31100 | |
| Density | 1.06g/cm3 | Boiling Point | 290.2ºC at 760 mmHg | |
| Molecular Formula | C13H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.9ºC | |
Use of TigloidinTigloidin is an analogue of atropine, with anticholinergic activity. |
| Name | (3-exo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl (2E)-2-methyl-2-bute noate |
|---|---|
| Synonym | More Synonyms |
| Description | Tigloidin is an analogue of atropine, with anticholinergic activity. |
|---|---|
| Related Catalog | |
| In Vivo | Tigloidine hydrobromide (20-60 mg/kg, i.p.) fails to protect the mice against the lethal effect of physostigmine, but at 100 mg/kg and above, it protects 80% of the animals against the lethal effect. Tigloidine markedly prevents tremor and salivation produced by tremorine at 80-100 mg/kg, but fails to prevent these effects in doses up to 40 mg/kg. Tigloidine (up to 100 mg/kg, i.p) does not significantly affects reserpine and tetrabenazine induced sedation and ptosis in mice. Tigloidine (25-50 mg/kg, i.p.) also fails to cause any behavioral changes in the cats[1]. |
| References |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 290.2ºC at 760 mmHg |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.31100 |
| Flash Point | 99.9ºC |
| Exact Mass | 223.15700 |
| PSA | 29.54000 |
| LogP | 2.05890 |
| Vapour Pressure | 0.0021mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | UVHGSMZRSVGWDJ-ZCFDAEMWSA-N |
| SMILES | CC=C(C)C(=O)OC1CC2CCC(C1)N2C |
| Storage condition | 2-8℃ |
|
~%
Tigloidin CAS#:495-83-0 |
| Literature: Rabot; Peerless; Robins Phytochemistry, 1995 , vol. 39, # 2 p. 315 - 322 |
|
~%
Tigloidin CAS#:495-83-0 |
| Literature: Barger et al. Journal of the Chemical Society, 1937 , p. 1820,1823 |
| (E)-2-methylbut-2-enoic acid methyl ester |
| Methyl-2-methylcrotonat |
| methyl 2-methylcrotonate |
| 2-Carbomethoxy-2-bute |
| methylalpha-methylcrotonate |
| tiglic acid methyl ester |
| (E)-methyl 2-methylbut-2-enoate |
| dimethylacrylic acid methyl ester |
| Tiglinsaeure-tropan-3exo-ylester |
| methyl (E)-2,3-dimethylpropenolate |
| Tiglic acid methyl |
| Methyltiglate |
| tiglic acid tropane-3exo-yl ester |
| 2-methyl-but-2-enoic acid methyl ester |
| methyl(e)-2-methylcrotonate |
| Tigloidin |