tert-Butyl 4-(hydroxymethyl)thiazol-2-ylcarbamate structure
|
Common Name | tert-Butyl 4-(hydroxymethyl)thiazol-2-ylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 494769-44-7 | Molecular Weight | 230.284 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-[4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.284 |
| Exact Mass | 230.072510 |
| PSA | 99.69000 |
| LogP | 0.69 |
| Index of Refraction | 1.590 |
| InChIKey | OWLBQQTUOQLZST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1nc(CO)cs1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methyl-2-propanyl [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamate |
| N-Boc-2-Amino-(4-hydroxymethyl)thiazole |
| tert-butyl 4-(hydroxymethyl)thiazol-2-ylcarbamate |
| Carbamic acid, N-[4-(hydroxymethyl)-2-thiazolyl]-, 1,1-dimethylethyl ester |
| 2-[(tert-butoxycarbonyl)amino]-4-hydroxymethylthiazole |
| tert-Butyl [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamate |
| tert-butyl 4-(hydroxymethyl)-1,3-thiazol-2-ylcarbamate |
| 1,1-dimethylethyl [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamate |
| (2-N-Boc-Aminothiazol-4-yl)methanol |
| (4-Hydroxymethylthiazol-2-yl)carbamicacidtert-butylester |
| t-butyl [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamate |