4-(TERT-BUTOXYCARBONYL)PHENYL ISOTHIOCYANATE structure
|
Common Name | 4-(TERT-BUTOXYCARBONYL)PHENYL ISOTHIOCYANATE | ||
|---|---|---|---|---|
| CAS Number | 486415-37-6 | Molecular Weight | 235.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | tert-butyl 4-isothiocyanatobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO2S |
|---|---|
| Molecular Weight | 235.30200 |
| Exact Mass | 235.06700 |
| PSA | 70.75000 |
| LogP | 3.37620 |
| InChIKey | LXVVKZRNRVNESX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(N=C=S)cc1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H312-H317-H332-H334 |
| Supplemental HS | Contact with acids liberates very toxic gas. |
| Precautionary Statements | P261-P280-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-32-42 |
| Safety Phrases | 22-36/37-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
|
~88%
4-(TERT-BUTOXYC... CAS#:486415-37-6 |
| Literature: Chu, Shao Song; Alegria, Larry Andrew; Bleckman, Ted Michael; Chong, Wesley Kwan Mung; Duvadie, Rohit K.; Li, Lin; Reich, Siegfried Heinz; Romines III, William Henry; Wallace, Michael B.; Yang, Yi Patent: US2003/225147 A1, 2003 ; Location in patent: Page 48 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-isothiocyanato-benzoic acid tert-butyl ester |
| 4-isothiocyanato-benzoic acid t-butyl ester |
| 4-(tert-Butoxycarbonyl)phenyl isothiocyanate |