4-chlorobut-2-ynyl N-(4-chlorophenyl)carbamate
Modify Date: 2025-08-23 16:21:33
4-chlorobut-2-ynyl N-(4-chlorophenyl)carbamate structure
|
Common Name | 4-chlorobut-2-ynyl N-(4-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 4835-23-8 | Molecular Weight | 258.10100 | |
| Density | 1.394g/cm3 | Boiling Point | 342.4ºC at 760 mmHg | |
| Molecular Formula | C11H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.9ºC | |
| Name | 4-chlorobut-2-yn-1-yl (4-chlorophenyl)carbamate |
|---|
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 342.4ºC at 760 mmHg |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10100 |
| Flash Point | 160.9ºC |
| Exact Mass | 257.00100 |
| PSA | 38.33000 |
| LogP | 3.20370 |
| Index of Refraction | 1.607 |
| InChIKey | QBEXUBXQPHUBEC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCC#CCCl |
|
~%
4-chlorobut-2-y... CAS#:4835-23-8 |
| Literature: Hopkins et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 2040 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |