4-chlorobut-2-ynyl N-(3-nitrophenyl)carbamate
Modify Date: 2025-10-17 15:03:23
4-chlorobut-2-ynyl N-(3-nitrophenyl)carbamate structure
|
Common Name | 4-chlorobut-2-ynyl N-(3-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 4835-21-6 | Molecular Weight | 268.65300 | |
| Density | 1.452g/cm3 | Boiling Point | 376.8ºC at 760 mmHg | |
| Molecular Formula | C11H9ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | 4-chlorobut-2-ynyl N-(3-nitrophenyl)carbamate |
|---|
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 376.8ºC at 760 mmHg |
| Molecular Formula | C11H9ClN2O4 |
| Molecular Weight | 268.65300 |
| Flash Point | 181.7ºC |
| Exact Mass | 268.02500 |
| PSA | 84.15000 |
| LogP | 2.98170 |
| Index of Refraction | 1.627 |
| InChIKey | OMSSGXSUXDPMMK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)OCC#CCCl |
|
~%
4-chlorobut-2-y... CAS#:4835-21-6 |
| Literature: Hopkins et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 2040 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |