2-methoxybenzylmagnesium chloride structure
|
Common Name | 2-methoxybenzylmagnesium chloride | ||
|---|---|---|---|---|
| CAS Number | 480438-46-8 | Molecular Weight | 180.91400 | |
| Density | 0.910 g/mL at 25ºC | Boiling Point | 65ºC | |
| Molecular Formula | C8H9ClMgO | Melting Point | -136°C | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1-methanidyl-2-methoxybenzene,chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.910 g/mL at 25ºC |
|---|---|
| Boiling Point | 65ºC |
| Melting Point | -136°C |
| Molecular Formula | C8H9ClMgO |
| Molecular Weight | 180.91400 |
| Flash Point | 1 °F |
| Exact Mass | 180.01900 |
| PSA | 9.23000 |
| LogP | 2.70040 |
| Appearance of Characters | Solution | Light yellow to brown to black |
| InChIKey | CCNUBJUSQCADGU-UHFFFAOYSA-M |
| SMILES | [CH2-]c1ccccc1OC.[Cl-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | Miscible with tetrahydrofuran. |
| Hazard Codes | F,C |
|---|---|
| Risk Phrases | 11-14-19-22-34 |
| Safety Phrases | 16-26-33-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 3.0 |
| HS Code | 29310099 |
|
~%
2-methoxybenzyl... CAS#:480438-46-8 |
| Literature: PFIZER LIMITED; PFIZER INC. Patent: WO2005/68447 A1, 2005 ; Location in patent: Page/Page column 54; 55 ; WO 2005/068447 A1 |
|
~%
2-methoxybenzyl... CAS#:480438-46-8 |
| Literature: Ross, Jennifer-Nicola; Wardell, James; Ferguson, George; Low, John N. Acta Crystallographica, Section C: Crystal Structure Communications, 1994 , vol. 50, # 6 p. 976 - 977 |
| 2-Methoxybenzylmagnesium chloride 0.25 M in Tetrahydrofuran |
| Grignard reagent from 2-methoxybenzyl chloride |
| MFCD01319897 |
| 2-Methoxybenzylmagnesium chloride solution |
| 2-Methoxybenzylmagnesium chloride |