Jaconine structure
|
Common Name | Jaconine | ||
|---|---|---|---|---|
| CAS Number | 480-75-1 | Molecular Weight | 387.85500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26ClNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JaconineJaconine is a natural product that can be isolated from honey of the Ragwort (Senecio jacobaea)[1]. |
| Name | (20R)-20-chloro-12,15-dihydroxy-(15αH)-15,20-dihydro-senecionane-11,16-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Jaconine is a natural product that can be isolated from honey of the Ragwort (Senecio jacobaea)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H26ClNO6 |
|---|---|
| Molecular Weight | 387.85500 |
| Exact Mass | 387.14500 |
| PSA | 96.30000 |
| LogP | 0.54280 |
| InChIKey | CKPJPJSVQMEGBC-UHFFFAOYSA-N |
| SMILES | CC1CC(O)(C(C)Cl)C(=O)OC2CCN3CC=C(COC(=O)C1(C)O)C23 |
| (4aR,7R,9R,10R,13bR)-7-((R)-1-Chloro-ethyl)-7,10-dihydroxy-9,10-dimethyl-2,3,4,4a,7,8,9,10,13,13b-decahydro-5,12-dioxa-2a-aza-cyclododeca[cd]pentalene-6,11-dione |
| Jaconin |
| jaconine |
| (20R)-20-chloro-12,15-dihydroxy-(15αH)-15,20-dihydro-senecionan-11,16-dione |
| (20R)-20-Chlor-12,15-dihydroxy-(15αH)-15,20-dihydro-senecionan-11,16-dion |