1-Boc-4-(3-Amino-6-bromopyrazin-2-yl)piperazine structure
|
Common Name | 1-Boc-4-(3-Amino-6-bromopyrazin-2-yl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 479685-13-7 | Molecular Weight | 358.23400 | |
| Density | 1.463g/cm3 | Boiling Point | 478.617ºC at 760 mmHg | |
| Molecular Formula | C13H20BrN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.259ºC | |
| Name | 1-Boc-4-(3-Amino-6-bromopyrazin-2-yl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 478.617ºC at 760 mmHg |
| Molecular Formula | C13H20BrN5O2 |
| Molecular Weight | 358.23400 |
| Flash Point | 243.259ºC |
| Exact Mass | 357.08000 |
| PSA | 84.58000 |
| LogP | 2.46250 |
| Index of Refraction | 1.593 |
| InChIKey | LJDVAJMXKQFLJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(Br)cnc2N)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-(3-amino-6-bromopyrazin-2-yl)piperazine-1-carboxylate |