1H-Pyrrolo[2,3-b]pyridin-4-yl trifluoromethanesulfonate structure
|
Common Name | 1H-Pyrrolo[2,3-b]pyridin-4-yl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 479552-94-8 | Molecular Weight | 266.19700 | |
| Density | 1.701g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H5F3N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 1H-Pyrrolo[2,3-b]pyridin-4-yl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.701g/cm3 |
|---|---|
| Molecular Formula | C8H5F3N2O3S |
| Molecular Weight | 266.19700 |
| Exact Mass | 265.99700 |
| PSA | 80.43000 |
| LogP | 2.87210 |
| Index of Refraction | 1.573 |
| InChIKey | LRYTVOHQGBBSAZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccnc2[nH]ccc12)C(F)(F)F |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-pyrrolo[2,3-b]pyridin-4-yl trifluoromethanesulfonate |