N,4-diphenylpiperazine-1-carboxamide
Modify Date: 2025-09-21 17:52:08
N,4-diphenylpiperazine-1-carboxamide structure
|
Common Name | N,4-diphenylpiperazine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 4791-20-2 | Molecular Weight | 281.35200 | |
| Density | 1.216g/cm3 | Boiling Point | 511.7ºC at 760 mmHg | |
| Molecular Formula | C17H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | N,4-diphenylpiperazine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 511.7ºC at 760 mmHg |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.35200 |
| Flash Point | 263.3ºC |
| Exact Mass | 281.15300 |
| PSA | 35.58000 |
| LogP | 3.11660 |
| Index of Refraction | 1.644 |
| InChIKey | SAKOVSGMQXGABX-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)N1CCN(c2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-piperazinecarboxamide,n,4-diphenyl |
| 4-phenyl-piperazine-1-carboxylic acid anilide |