N-(tert-Butoxycarbonyl)-4-fluoro-L-phenylalanine structure
|
Common Name | N-(tert-Butoxycarbonyl)-4-fluoro-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 479064-94-3 | Molecular Weight | 283.295 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18FNO4 | Melting Point | 100-102 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 214.6±27.3 °C | |
| Name | boc-(r)-3-amino-3-(4-fluoro-phenyl)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.2±40.0 °C at 760 mmHg |
| Melting Point | 100-102 °C(lit.) |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.295 |
| Flash Point | 214.6±27.3 °C |
| Exact Mass | 283.121979 |
| PSA | 75.63000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | WRVBNEFIXONNFA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1ccc(F)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-Phe(4-F)-OH |
| (R)-3-((tert-Butoxycarbonyl)amino)-3-(4-fluorophenyl)propanoic acid |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-fluoro- |
| Boc-D-b-Phe(4-F)-OH |
| Boc-4-Fluoro-Phe-OH |
| N-Boc-4-fluoro-L-phenylalanine |
| Boc-(R)-3-Amino-3-(4-fluorophenyl)propionic acid |
| BOC-PHG(4-F)-(C*CH2)OH |
| MFCD03427957 |
| (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| N-(tert-Butoxycarbonyl)-4-fluoro-L-phenylalanine |
| Boc--R-4-Fluorophenylalanine |
| RARECHEM DK TC T330 |
| (2S)-3-(4-Fluorophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 4-Fluoro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |