5-(4-aminophenyl)-2-phenyl-4H-pyrazol-3-one structure
|
Common Name | 5-(4-aminophenyl)-2-phenyl-4H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 478398-27-5 | Molecular Weight | 251.28300 | |
| Density | 1.26g/cm3 | Boiling Point | 428.9ºC at 760 mmHg | |
| Molecular Formula | C15H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | 5-(4-aminophenyl)-2-phenyl-4H-pyrazol-3-one |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 428.9ºC at 760 mmHg |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.28300 |
| Flash Point | 213.2ºC |
| Exact Mass | 251.10600 |
| PSA | 58.69000 |
| LogP | 2.49160 |
| Index of Refraction | 1.667 |
| InChIKey | NGWUZQIBRQVPOT-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C2=NN(c3ccccc3)C(=O)C2)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |