Pseudoaspidin
Modify Date: 2025-08-26 20:14:22
Pseudoaspidin structure
|
Common Name | Pseudoaspidin | ||
|---|---|---|---|---|
| CAS Number | 478-28-4 | Molecular Weight | 460.51700 | |
| Density | N/A | Boiling Point | 647.7±55.0 °C | |
| Molecular Formula | C25H32O8 | Melting Point | 142-144 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of PseudoaspidinPseudoaspidin is isolated from the ferns of the class Pterophyta or Filicinae[1]. |
| Name | bis-(3-butyryl-2,6-dihydroxy-4-methoxy-5-methyl-phenyl)-methane |
|---|---|
| Synonym | More Synonyms |
| Description | Pseudoaspidin is isolated from the ferns of the class Pterophyta or Filicinae[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 647.7±55.0 °C |
|---|---|
| Melting Point | 142-144 °C |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.51700 |
| Exact Mass | 460.21000 |
| PSA | 133.52000 |
| LogP | 4.69940 |
| InChIKey | ASBDWVACJRRBIZ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1c(O)c(Cc2c(O)c(C)c(OC)c(C(=O)CCC)c2O)c(O)c(C)c1OC |
| Pseudoaspidin |