4-Quinolinecarboxylicacid, 2-phenyl-, hydrazide structure
|
Common Name | 4-Quinolinecarboxylicacid, 2-phenyl-, hydrazide | ||
|---|---|---|---|---|
| CAS Number | 4779-54-8 | Molecular Weight | 263.29400 | |
| Density | 1.256g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenylquinoline-4-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.29400 |
| Exact Mass | 263.10600 |
| PSA | 68.01000 |
| LogP | 3.59650 |
| Index of Refraction | 1.681 |
| InChIKey | OXZWSKCISAPCJD-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-cinchoninic acid hydrazide |
| 4-hydrazido-2-phenylquinoline |
| 2-phenylquinolyl-4-formylhydrazide |
| 2-phenylquinoline-4-carboxylic acid hydrazide |
| 2PhQuinolCON2 |
| 2-Phenyl-chinolin-4-carbonsaeure-hydrazid |
| 2-phenyl-4-quinolinecarbohydrazide |