Lushanrubescensin H structure
|
Common Name | Lushanrubescensin H | ||
|---|---|---|---|---|
| CAS Number | 476640-22-9 | Molecular Weight | 390.470 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 574.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3±23.6 °C | |
Use of Lushanrubescensin HLushanrubescensin H (Rabdoternin H) is an ent-Kaurane diterpenoid from Isodon ternifolius aboveground part[1]. |
| Name | (1S,1'S,2S,6R,6'S,9'R)-6-(Hydroxymethyl)-5,5-dimethyl-10'-methylene-2',11'-dioxo-3'-oxaspiro[cyclohexane-1,5'-tricyclo[7.2.1.01,6]dodecan]-2-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Lushanrubescensin H (Rabdoternin H) is an ent-Kaurane diterpenoid from Isodon ternifolius aboveground part[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.4±50.0 °C at 760 mmHg |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.470 |
| Flash Point | 198.3±23.6 °C |
| Exact Mass | 390.204254 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | RAWOPLHURKGKQI-UHFFFAOYSA-N |
| SMILES | C=C1C(=O)C23CC1CCC2C1(COC3=O)C(OC(C)=O)CCC(C)(C)C1CO |
| (1S,1'S,2S,6R,6'S,9'R)-6-(Hydroxymethyl)-5,5-dimethyl-10'-methylene-2',11'-dioxo-3'-oxaspiro[cyclohexane-1,5'-tricyclo[7.2.1.01,6]dodecan]-2-yl acetate |