Mebeverine Acid structure
|
Common Name | Mebeverine Acid | ||
|---|---|---|---|---|
| CAS Number | 475203-77-1 | Molecular Weight | 279.37500 | |
| Density | 1.057g/cm3 | Boiling Point | 428.2ºC at 760 mmHg | |
| Molecular Formula | C16H25NO3 | Melting Point | 85-87ºC | |
| MSDS | N/A | Flash Point | 212.7ºC | |
Use of Mebeverine AcidMebeverine acid is a metabolite of Mebeverine, which is a musculotropic antispasmodic drug. |
| Name | Mebeverine Acid |
|---|---|
| Synonym | More Synonyms |
| Description | Mebeverine acid is a metabolite of Mebeverine, which is a musculotropic antispasmodic drug. |
|---|---|
| Related Catalog |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 428.2ºC at 760 mmHg |
| Melting Point | 85-87ºC |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.37500 |
| Flash Point | 212.7ºC |
| Exact Mass | 279.18300 |
| PSA | 49.77000 |
| LogP | 2.81290 |
| Index of Refraction | 1.519 |
| InChIKey | UZUWRVLVHOYTNN-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(=O)O)C(C)Cc1ccc(OC)cc1 |
| Storage condition | -20°C |
| 4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butanoic acid |
| Mebeverine metabolite Mebeverine acid |