1,1,3,3-Propanetetracarboxylic acid structure
|
Common Name | 1,1,3,3-Propanetetracarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4721-45-3 | Molecular Weight | 220.13400 | |
| Density | 1.784g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C7H8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | propane-1,1,3,3-tetracarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.784g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Molecular Formula | C7H8O8 |
| Molecular Weight | 220.13400 |
| Flash Point | 223.4ºC |
| Exact Mass | 220.02200 |
| PSA | 149.20000 |
| Index of Refraction | 1.573 |
| InChIKey | NJEVMKZODGWUQT-UHFFFAOYSA-N |
| SMILES | O=C(O)C(CC(C(=O)O)C(=O)O)C(=O)O |
|
~%
1,1,3,3-Propane... CAS#:4721-45-3 |
| Literature: Westphal Journal of the American Chemical Society, 1958 , vol. 80, p. 871,873, 874, 876 |
|
~%
1,1,3,3-Propane... CAS#:4721-45-3 |
| Literature: Conrad; Guthzeit Justus Liebigs Annalen der Chemie, 1884 , vol. 222, p. 253 |
|
~%
1,1,3,3-Propane... CAS#:4721-45-3 |
| Literature: Kleber Justus Liebigs Annalen der Chemie, 1888 , vol. 246, p. 100 |
| 1,1,3,3-Propanetetracarboxylic acid |
| Propan-1,1,3,3-tetracarbonsaeure |
| Propane-tetracarboxylic acid |