1,1-Bis(4-cyanatophenyl)ethane structure
|
Common Name | 1,1-Bis(4-cyanatophenyl)ethane | ||
|---|---|---|---|---|
| CAS Number | 47073-92-7 | Molecular Weight | 264.27900 | |
| Density | 1.196 | Boiling Point | 383ºC | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149ºC | |
| Name | [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196 |
|---|---|
| Boiling Point | 383ºC |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.27900 |
| Flash Point | 149ºC |
| Exact Mass | 264.09000 |
| PSA | 66.04000 |
| LogP | 3.55816 |
| Index of Refraction | 1.578 |
| InChIKey | SIZDMAYTWUINIG-UHFFFAOYSA-N |
| SMILES | CC(c1ccc(OC#N)cc1)c1ccc(OC#N)cc1 |
| Hazard Codes | Xn,N |
|---|---|
| Risk Phrases | R20/22 |
| Safety Phrases | 26-36/37/39-60-61 |
| HS Code | 2929909090 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ethane-1,1-diyldi-4,1-phenylene dicyanate |
| bisphenol E cyanate ester |