2-Chloro-4-trimethylsilanylethynyl-nicotinic acid methyl ester
Modify Date: 2025-11-29 12:57:33
2-Chloro-4-trimethylsilanylethynyl-nicotinic acid methyl ester structure
|
Common Name | 2-Chloro-4-trimethylsilanylethynyl-nicotinic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 470463-44-6 | Molecular Weight | 267.78400 | |
| Density | 1.16g/cm3 | Boiling Point | 329.7ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.2ºC | |
| Name | 2-Chloro-4-trimethylsilanylethynyl-nicotinic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 329.7ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO2Si |
| Molecular Weight | 267.78400 |
| Flash Point | 153.2ºC |
| Exact Mass | 267.04800 |
| PSA | 39.19000 |
| LogP | 2.75050 |
| Index of Refraction | 1.522 |
| InChIKey | YXAFNLLWRMATGC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C#C[Si](C)(C)C)ccnc1Cl |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-chloro-4-(2-trimethylsilylethynyl)pyridine-3-carboxylate |