Jervinone structure
|
Common Name | Jervinone | ||
|---|---|---|---|---|
| CAS Number | 469-60-3 | Molecular Weight | 423.58800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H37NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JervinoneJervinone is a metabolite of the Veratrum alkaloid, which can be isolated from the mold Cunninghamella echinulata[1]. |
| Name | (22Ξ,23S)-17,23-epoxy-(17αH)-veratra-4,12-diene-3,11-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Jervinone is a metabolite of the Veratrum alkaloid, which can be isolated from the mold Cunninghamella echinulata[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H37NO3 |
|---|---|
| Molecular Weight | 423.58800 |
| Exact Mass | 423.27700 |
| PSA | 55.40000 |
| LogP | 4.71790 |
| InChIKey | KLTPAUQDYRELPI-WKWNSBFHSA-N |
| SMILES | CC1=C2C(=O)C3C(CCC4=CC(=O)CCC43C)C2CCC12OC1CC(C)CNC1C2C |
| Jervon, 22,27-Imino-17,23-oxido-Δ4,12-jervadien-3,11-dion |