17-Methyllycodin-1(18H)-one
Modify Date: 2025-08-26 21:31:06
17-Methyllycodin-1(18H)-one structure
|
Common Name | 17-Methyllycodin-1(18H)-one | ||
|---|---|---|---|---|
| CAS Number | 467-79-8 | Molecular Weight | 272.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 17-Methyllycodin-1(18H)-oneβ-Obscurine is a lycopodine-type alkaloid, which can be isolated from the club moss Lycopodium casuarinoides[1]. |
| Name | β-obscurine |
|---|---|
| Synonym | More Synonyms |
| Description | β-Obscurine is a lycopodine-type alkaloid, which can be isolated from the club moss Lycopodium casuarinoides[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H24N2O |
|---|---|
| Molecular Weight | 272.39 |
| Exact Mass | 272.18900 |
| PSA | 36.36000 |
| LogP | 2.86440 |
| Vapour Pressure | 6.69E-10mmHg at 25°C |
| InChIKey | SIQKNJDHWYZFFT-IPJQOSJUSA-N |
| SMILES | CC1CC2Cc3[nH]c(=O)ccc3C3(C1)C2CCCN3C |
| (12R)-1,12-dimethyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-propano-1,7-phenanthrolin-8-ol |
| beta-obscurine |
| (1R,9S,10R,16R)-14,16-dimethyl-6,14-diazatetracyclo[7.5.3.0(1,10).0(2,7)]heptadeca-2(7),3-dien-5-one |