1,4-dihydroxy-2-morpholin-4-yl-anthracene-9,10-dione
Modify Date: 2024-09-23 15:29:35
1,4-dihydroxy-2-morpholin-4-yl-anthracene-9,10-dione structure
|
Common Name | 1,4-dihydroxy-2-morpholin-4-yl-anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 4644-03-5 | Molecular Weight | 325.31500 | |
| Density | 1.483g/cm3 | Boiling Point | 622.6ºC at 760 mmHg | |
| Molecular Formula | C18H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.3ºC | |
| Name | 1,4-dihydroxy-2-morpholin-4-ylanthracene-9,10-dione |
|---|
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 622.6ºC at 760 mmHg |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.31500 |
| Flash Point | 330.3ºC |
| Exact Mass | 325.09500 |
| PSA | 87.07000 |
| LogP | 1.77480 |
| Index of Refraction | 1.694 |
| InChIKey | GZTDHHJOBWJCMJ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(N3CCOCC3)cc(O)c21 |
| HS Code | 2934999090 |
|---|
|
~40%
1,4-dihydroxy-2... CAS#:4644-03-5 |
| Literature: Loskutov; Nekhoroshev Russian Journal of Organic Chemistry, 2002 , vol. 38, # 10 p. 1519 - 1524 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |