Maculosin structure
|
Common Name | Maculosin | ||
|---|---|---|---|---|
| CAS Number | 4549-02-4 | Molecular Weight | 260.29 | |
| Density | 1.36g/cm3 | Boiling Point | 581.4ºC at 760mmHg | |
| Molecular Formula | C14H16N2O3 | Melting Point | 156-159 °C | |
| MSDS | N/A | Flash Point | 305.4ºC | |
Use of MaculosinMaculosin is a host-specific phytotoxin for spotted knapweed from Alternaria alternata. Maculosin is a quorum-sensing molecule involved in cell-cell communication by Pseudomonas aeruginosa. Maculosin also acts as a signaling molecule regulating virulence gene expression in Lactobacillus reuteri. Maculosin shows antioxidant, anti-cancer and non-toxicity properties. Maculosin shows cytotoxic activity against the human liver cancer cell lines, with an IC50 of 48.90 µg/mL[1][2][3]. |
| Name | maculosin |
|---|---|
| Synonym | More Synonyms |
| Description | Maculosin is a host-specific phytotoxin for spotted knapweed from Alternaria alternata. Maculosin is a quorum-sensing molecule involved in cell-cell communication by Pseudomonas aeruginosa. Maculosin also acts as a signaling molecule regulating virulence gene expression in Lactobacillus reuteri. Maculosin shows antioxidant, anti-cancer and non-toxicity properties. Maculosin shows cytotoxic activity against the human liver cancer cell lines, with an IC50 of 48.90 µg/mL[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 581.4ºC at 760mmHg |
| Melting Point | 156-159 °C |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 |
| Flash Point | 305.4ºC |
| Exact Mass | 260.11600 |
| PSA | 69.64000 |
| LogP | 0.69080 |
| Index of Refraction | 1.644 |
| InChIKey | LSGOTAXPWMCUCK-RYUDHWBXSA-N |
| SMILES | O=C1NC(Cc2ccc(O)cc2)C(=O)N2CCCC12 |
| Storage condition | -15°C |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3S,8aS)-3-[(4-hydroxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| TYP |
| CYCLO-(L-TYROSINE-L-PROLINE) INHIBITOR |
| cyclo-L-Tyr-L-Pro |
| cyclo(D-Pro-D-Tyr) |
| (3s,8as)-3-(4-hydroxybenzyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| cycl(L-pro-L-tyr) |
| 1w1y |
| cyclo(L-prolinyl-L-tyrosine) |
| (3S,8AR)-3-(4-HYDROXYBENZYL)HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE |
| Cyclo(L-pro-L-tyr) |
| Maculosin |
| Cyclo-(Pro-Tyr) |