Solabegron structure
|
Common Name | Solabegron | ||
|---|---|---|---|---|
| CAS Number | 451470-34-1 | Molecular Weight | 410.893 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 672.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H24Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.4±31.5 °C | |
| Name | 3-[3-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]benzoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 672.4±55.0 °C at 760 mmHg |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 410.893 |
| Flash Point | 360.4±31.5 °C |
| Exact Mass | 410.139709 |
| PSA | 81.59000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | PMXCGBVBIRYFPR-FTBISJDPSA-N |
| SMILES | Cl.O=C(O)c1cccc(-c2cccc(NCCNCC(O)c3cccc(Cl)c3)c2)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-[(2-{[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino}ethyl)amino]biphenyl-3-carboxylic acid |
| Solabegron hydrochloride (USAN) |
| (R)-3'-((2-((2-(3-Chlorophenyl)-2-hydroxyethyl)amino)ethyl)amino)-[1,1'-biphenyl]-3-carboxylic acid |
| 3-[3-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]benzoic acid |
| GW-427,353 |
| UNII:55P6YH9O6N |
| UNII-GU14FR8D4A |
| 3'-[(2-{[(2R)-2-(3-Chlorophenyl)-2-hydroxyethyl]amino}ethyl)amino]-3-biphenylcarboxylic acid |
| Solabegron HCl |
| [1,1'-Biphenyl]-3-carboxylic acid, 3'-[[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]amino]- |
| 3'-((2-((2-(3-Chlorophenyl)-2-hydroxyethyl)amino)ethyl)amino)-(1,1'-biphenyl)-3-carboxylic acid |
| Solabegron |