benzenesulphonic acid, compound with aniline (1:1)
Modify Date: 2025-09-24 04:08:14
benzenesulphonic acid, compound with aniline (1:1) structure
|
Common Name | benzenesulphonic acid, compound with aniline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4484-20-2 | Molecular Weight | 251.30200 | |
| Density | N/A | Boiling Point | 479.7ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9ºC | |
| Name | aniline,benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 479.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.30200 |
| Flash Point | 243.9ºC |
| Exact Mass | 251.06200 |
| PSA | 88.77000 |
| LogP | 3.86410 |
| InChIKey | NGYOVXUBIWJNIU-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1.O=S(=O)(O)c1ccccc1 |
| Anilin,Benzolsulfonat |
| EINECS 224-767-8 |
| aniline benzenesulfonate |
| Anilinyl benzenesulfonate |