benzenesulphonic acid, compound with 2-anilinoethanol (1:1) structure
|
Common Name | benzenesulphonic acid, compound with 2-anilinoethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93857-36-4 | Molecular Weight | 295.35400 | |
| Density | N/A | Boiling Point | 549.8ºC at 760 mmHg | |
| Molecular Formula | C14H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.3ºC | |
| Name | 2-anilinoethanol,benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 549.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.35400 |
| Flash Point | 286.3ºC |
| Exact Mass | 295.08800 |
| PSA | 95.01000 |
| LogP | 3.17790 |
| InChIKey | FJIRJJVJTINMQF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccccc1.OCCNc1ccccc1 |
| einecs 299-169-3 |