1-methoxy-N-[(4-nitrophenyl)methyl]propan-2-amine
Modify Date: 2025-09-20 16:44:03
![1-methoxy-N-[(4-nitrophenyl)methyl]propan-2-amine Structure](https://image.chemsrc.com/caspic/164/444907-60-2.png)
1-methoxy-N-[(4-nitrophenyl)methyl]propan-2-amine structure
|
Common Name | 1-methoxy-N-[(4-nitrophenyl)methyl]propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 444907-60-2 | Molecular Weight | 224.25600 | |
| Density | 1.125g/cm3 | Boiling Point | 332.4ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | 1-methoxy-N-[(4-nitrophenyl)methyl]propan-2-amine |
|---|
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 332.4ºC at 760 mmHg |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 154.9ºC |
| Exact Mass | 224.11600 |
| PSA | 67.08000 |
| LogP | 2.63340 |
| Index of Refraction | 1.53 |
| InChIKey | SJNSLXDMVRQGGZ-UHFFFAOYSA-N |
| SMILES | COCC(C)NCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |