1-methoxy-N-[(4-methoxynaphthalen-1-yl)methyl]propan-2-amine
Modify Date: 2025-09-18 15:37:05
![1-methoxy-N-[(4-methoxynaphthalen-1-yl)methyl]propan-2-amine Structure](https://image.chemsrc.com/caspic/403/353778-44-6.png)
1-methoxy-N-[(4-methoxynaphthalen-1-yl)methyl]propan-2-amine structure
|
Common Name | 1-methoxy-N-[(4-methoxynaphthalen-1-yl)methyl]propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 353778-44-6 | Molecular Weight | 259.34300 | |
| Density | 1.056g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C16H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.2ºC | |
| Name | 1-methoxy-N-[(4-methoxynaphthalen-1-yl)methyl]propan-2-amine |
|---|
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.34300 |
| Flash Point | 161.2ºC |
| Exact Mass | 259.15700 |
| PSA | 30.49000 |
| LogP | 3.36380 |
| Index of Refraction | 1.561 |
| InChIKey | HZARHADGQPNARO-UHFFFAOYSA-N |
| SMILES | COCC(C)NCc1ccc(OC)c2ccccc12 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |