1-(2-CHLORO-ACETYL)-3-PROPYL-UREA
Modify Date: 2025-12-01 16:13:08
1-(2-CHLORO-ACETYL)-3-PROPYL-UREA structure
|
Common Name | 1-(2-CHLORO-ACETYL)-3-PROPYL-UREA | ||
|---|---|---|---|---|
| CAS Number | 4399-77-3 | Molecular Weight | 263.67600 | |
| Density | 1.456g/cm3 | Boiling Point | 469.8ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO3 | Melting Point | 246-248ºC | |
| MSDS | N/A | Flash Point | 237.9ºC | |
| Name | 1-[(2-chlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 469.8ºC at 760 mmHg |
| Melting Point | 246-248ºC |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.67600 |
| Flash Point | 237.9ºC |
| Exact Mass | 263.03500 |
| PSA | 59.30000 |
| LogP | 2.24820 |
| Index of Refraction | 1.65 |
| InChIKey | UTHKVSFOOCIQAL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(=O)n(Cc2ccccc2Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-chlorobenzyl)-6-oxo-1,6-dihydro-3-pyridinecarboxylic acid |
| N-<2-Chlor-benzyl>-pyridon-(2)-carbonsaeure-(5) |
| F2153-0007 |
| 1-(2-chlorobenzyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid |