Isohexadecane structure
|
Common Name | Isohexadecane | ||
|---|---|---|---|---|
| CAS Number | 4390-04-9 | Molecular Weight | 226.441 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 240.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C16H34 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.6±0.0 °C | |
| Name | 2,2,4,4,6,8,8-heptamethylnonane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 240.0±0.0 °C at 760 mmHg |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.441 |
| Flash Point | 95.6±0.0 °C |
| Exact Mass | 226.266052 |
| LogP | 7.98 |
| Vapour density | 7.9 (vs air) |
| Vapour Pressure | 0.1±0.2 mmHg at 25°C |
| Index of Refraction | 1.432 |
| InChIKey | VCLJODPNBNEBKW-UHFFFAOYSA-N |
| SMILES | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| HS Code | 2901100000 |
|---|---|
| Summary | 2901100000 saturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| Nonane, 2,2,4,4,6,8,8-heptamethyl- |
| heptamethylnonane |
| UNII:8LP0677305 |
| MFCD00008856 |
| Isohexadecane |
| 2,2,4,4,6,8,8-Heptamethylnonane |
| EINECS 224-506-8 |
| 2,2,4,4,6,6-HEXAMETHYLCYCLOTRISILAZANE |
| isocetane |
| Nonane,2,2,4,4,6,8,8-heptamethyl |
| 2,2,4,4,6,8,8-heptamethyinonane |
| 2,2,4,4,6,8,8,-Heptamethylnonane |