Hexamethoxy Disiloxane structure
|
Common Name | Hexamethoxy Disiloxane | ||
|---|---|---|---|---|
| CAS Number | 4371-91-9 | Molecular Weight | 258.37400 | |
| Density | 0.94g/cm3 | Boiling Point | 73 °C/3 mmHg | |
| Molecular Formula | C6H18O7Si2 | Melting Point | <0C | |
| MSDS | N/A | Flash Point | 41 °C | |
| Name | Hexamethyl diorthosilicate Hexamethyl diorthosilicate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 73 °C/3 mmHg |
| Melting Point | <0C |
| Molecular Formula | C6H18O7Si2 |
| Molecular Weight | 258.37400 |
| Flash Point | 41 °C |
| Exact Mass | 258.05900 |
| PSA | 64.61000 |
| Index of Refraction | 1.38 |
| InChIKey | XOAJIYVOSJHEQB-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)O[Si](OC)(OC)OC |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 10-36/37/38 |
| Safety Phrases | 16-26-36/37/39 |
| HS Code | 2920909090 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Hexamethoxy Disiloxane |