2-[5-(4-Amino-phenyl)-tetrazol-2-yl]-1-pyrrolidin-1-yl-ethanone structure
|
Common Name | 2-[5-(4-Amino-phenyl)-tetrazol-2-yl]-1-pyrrolidin-1-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 436092-94-3 | Molecular Weight | 272.30600 | |
| Density | 1.46 g/cm3 | Boiling Point | 557.8ºC at 760 mmHg | |
| Molecular Formula | C13H16N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 2-[5-(4-Amino-phenyl)-tetrazol-2-yl]-1-pyrrolidin-1-yl-ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46 g/cm3 |
|---|---|
| Boiling Point | 557.8ºC at 760 mmHg |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.30600 |
| Flash Point | 291.1ºC |
| Exact Mass | 272.13900 |
| PSA | 89.93000 |
| LogP | 1.06380 |
| Index of Refraction | 1.734 |
| InChIKey | YHQGUEYCDLJEPR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2nnn(CC(=O)N3CCCC3)n2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[5-(4-aminophenyl)tetrazol-2-yl]-1-pyrrolidin-1-ylethanone |