N-(5-amino-2-methylphenyl)pyridine-4-carboxamide
Modify Date: 2025-08-25 20:02:24
N-(5-amino-2-methylphenyl)pyridine-4-carboxamide structure
|
Common Name | N-(5-amino-2-methylphenyl)pyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 436089-25-7 | Molecular Weight | 227.26200 | |
| Density | 1.261g/cm3 | Boiling Point | 335.3ºC at 760 mmHg | |
| Molecular Formula | C13H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | N-(5-amino-2-methylphenyl)pyridine-4-carboxamide |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 335.3ºC at 760 mmHg |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.26200 |
| Flash Point | 156.6ºC |
| Exact Mass | 227.10600 |
| PSA | 68.01000 |
| LogP | 2.87870 |
| Index of Refraction | 1.679 |
| InChIKey | OXDXXBXREHAVEA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)cc1NC(=O)c1ccncc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |