N-(4-Amino-2-methoxy-phenyl)-2-methyl-benzamide
Modify Date: 2025-08-27 21:24:24
N-(4-Amino-2-methoxy-phenyl)-2-methyl-benzamide structure
|
Common Name | N-(4-Amino-2-methoxy-phenyl)-2-methyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 436089-19-9 | Molecular Weight | 256.30000 | |
| Density | 1.215 g/cm3 | Boiling Point | 374ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | N-(4-Amino-2-methoxy-phenyl)-2-methyl-benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215 g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 180ºC |
| Exact Mass | 256.12100 |
| PSA | 64.35000 |
| LogP | 3.49230 |
| Index of Refraction | 1.646 |
| InChIKey | AWVHUIPCUFRJBM-UHFFFAOYSA-N |
| SMILES | COc1cc(N)ccc1NC(=O)c1ccccc1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-amino-2-methoxyphenyl)-2-methylbenzamide |