4-(2-Chloro-acetyl)-3,4-dihydro-1H-quinoxalin-2-one structure
|
Common Name | 4-(2-Chloro-acetyl)-3,4-dihydro-1H-quinoxalin-2-one | ||
|---|---|---|---|---|
| CAS Number | 436088-67-4 | Molecular Weight | 224.64400 | |
| Density | 1.382g/cm3 | Boiling Point | 0ºC | |
| Molecular Formula | C10H9ClN2O2 | Melting Point | 0ºC | |
| MSDS | N/A | Flash Point | 0ºC | |
| Name | 4-(2-Chloro-acetyl)-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 0ºC |
| Melting Point | 0ºC |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.64400 |
| Flash Point | 0ºC |
| Exact Mass | 224.03500 |
| PSA | 49.41000 |
| LogP | 1.41350 |
| Index of Refraction | 1.591 |
| InChIKey | RNGJPXOEWSLROI-UHFFFAOYSA-N |
| SMILES | O=C1CN(C(=O)CCl)c2ccccc2N1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
4-(2-Chloro-ace... CAS#:436088-67-4 |
| Literature: Archives of Pharmacal Research, , vol. 34, # 10 p. 1605 - 1614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2-chloroacetyl)-1,3-dihydroquinoxalin-2-one |