6-iodo-2-methylquinoline-4-carboxylic acid structure
|
Common Name | 6-iodo-2-methylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 433244-12-3 | Molecular Weight | 313.09100 | |
| Density | 1.867g/cm3 | Boiling Point | 418.6ºC at 760 mmHg | |
| Molecular Formula | C11H8INO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 207ºC | |
| Name | 6-iodo-2-methylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.867g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760 mmHg |
| Molecular Formula | C11H8INO2 |
| Molecular Weight | 313.09100 |
| Flash Point | 207ºC |
| Exact Mass | 312.96000 |
| PSA | 50.19000 |
| LogP | 2.84600 |
| Index of Refraction | 1.729 |
| InChIKey | GBYQKIVJBNZXTF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)c2cc(I)ccc2n1 |
| HS Code | 2933499090 |
|---|
|
~%
6-iodo-2-methyl... CAS#:433244-12-3 |
| Literature: Borsche; Weussmann; Fritzsche Chemische Berichte, 1924 , vol. 57, p. 1773 |
|
~%
6-iodo-2-methyl... CAS#:433244-12-3 |
| Literature: Borsche; Weussmann; Fritzsche Chemische Berichte, 1924 , vol. 57, p. 1773 |
|
~%
6-iodo-2-methyl... CAS#:433244-12-3 |
| Literature: Borsche; Weussmann; Fritzsche Chemische Berichte, 1924 , vol. 57, p. 1773 |
|
~%
6-iodo-2-methyl... CAS#:433244-12-3 |
| Literature: Borsche; Weussmann; Fritzsche Chemische Berichte, 1924 , vol. 57, p. 1773 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Jod-2-methyl-chinolin-4-carbonsaeure |
| 6-iodo-2-methyl-quinoline-4-carboxylic acid |