D-gluconic acid, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1)
Modify Date: 2025-08-25 19:16:45
D-gluconic acid, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1) structure
|
Common Name | D-gluconic acid, compound with (8alpha,9R)-6'-methoxycinchonan-9-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4325-25-1 | Molecular Weight | 520.57200 | |
| Density | N/A | Boiling Point | 495.9ºC at 760 mmHg | |
| Molecular Formula | C26H36N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | (5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methanol,2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 495.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.57200 |
| Flash Point | 253.7ºC |
| Exact Mass | 520.24200 |
| PSA | 184.04000 |
| InChIKey | XHKUDCCTVQUHJQ-BILMMMPYSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.O=C(O)C(O)C(O)C(O)C(O)CO |
| HS Code | 29392000 |
|---|
| Quinine gluconate |
| (S)-[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| magnesium gluconate anhydrous quinidine,dihydrate |
| Chinin-gluconat |
| (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |