Benzoicacid, 4-[[2,2,3,3,4,4,4-heptafluoro-1-(nitromethyl)butyl]amino]- structure
|
Common Name | Benzoicacid, 4-[[2,2,3,3,4,4,4-heptafluoro-1-(nitromethyl)butyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 432-78-0 | Molecular Weight | 378.20000 | |
| Density | 1.583g/cm3 | Boiling Point | 421.8ºC at 760mmHg | |
| Molecular Formula | C12H9F7N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 4-((3,3,4,4,5,5,5-heptafluoro-1-nitropentan-2-yl)amino)benzoic acid |
|---|
| Density | 1.583g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760mmHg |
| Molecular Formula | C12H9F7N2O4 |
| Molecular Weight | 378.20000 |
| Flash Point | 208.9ºC |
| Exact Mass | 378.04500 |
| PSA | 95.15000 |
| LogP | 3.87110 |
| Vapour Pressure | 7.19E-08mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | CKNLIADZKHYFMX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC(C[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)F)cc1 |
|
~%
Benzoicacid, 4-... CAS#:432-78-0 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
|
~%
Benzoicacid, 4-... CAS#:432-78-0 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |