2-Pentanol,3,3,4,4,5,5,5-heptafluoro-1-nitro- structure
|
Common Name | 2-Pentanol,3,3,4,4,5,5,5-heptafluoro-1-nitro- | ||
|---|---|---|---|---|
| CAS Number | 377-61-7 | Molecular Weight | 259.07900 | |
| Density | 1.619g/cm3 | Boiling Point | 210.8ºC at 760mmHg | |
| Molecular Formula | C5H4F7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.3ºC | |
| Name | 3,3,4,4,5,5,5-heptafluoro-1-nitropentan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.619g/cm3 |
|---|---|
| Boiling Point | 210.8ºC at 760mmHg |
| Molecular Formula | C5H4F7NO3 |
| Molecular Weight | 259.07900 |
| Flash Point | 81.3ºC |
| Exact Mass | 259.00800 |
| PSA | 66.05000 |
| LogP | 1.98010 |
| Index of Refraction | 1.342 |
| InChIKey | ZXFRDGBMIGOQJL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(O)C(F)(F)C(F)(F)C(F)(F)F |
|
~83%
2-Pentanol,3,3,... CAS#:377-61-7 |
| Literature: Dunn, Caroline; Gibson, Colin L.; Suckling, Colin J. Tetrahedron, 1996 , vol. 52, # 40 p. 13017 - 13026 |
|
~%
2-Pentanol,3,3,... CAS#:377-61-7 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
| 3,3,4,4,5,5,5-heptafluoro-1-nitro-pentan-2-ol |
| 3,3,4,4,5,5,5-Heptafluor-1-nitro-pentan-2-ol |