N-(2-bromophenyl)-2-(4-propan-2-ylphenoxy)acetamide
Modify Date: 2025-11-25 10:10:34
N-(2-bromophenyl)-2-(4-propan-2-ylphenoxy)acetamide structure
|
Common Name | N-(2-bromophenyl)-2-(4-propan-2-ylphenoxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 431995-26-5 | Molecular Weight | 348.23400 | |
| Density | 1.354g/cm3 | Boiling Point | 499ºC at 760 mmHg | |
| Molecular Formula | C17H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.6ºC | |
| Name | N-(2-bromophenyl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760 mmHg |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.23400 |
| Flash Point | 255.6ºC |
| Exact Mass | 347.05200 |
| PSA | 38.33000 |
| LogP | 4.66300 |
| Index of Refraction | 1.605 |
| InChIKey | CRZVJPJGYARLPB-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2ccccc2Br)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |