N-ethyl-2-nitro-N-phenylaniline structure
|
Common Name | N-ethyl-2-nitro-N-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 43199-97-9 | Molecular Weight | 242.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-ethyl-2-nitro-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O2 |
|---|---|
| Molecular Weight | 242.27300 |
| Exact Mass | 242.10600 |
| PSA | 49.06000 |
| LogP | 4.27600 |
| InChIKey | LPSMZJHWHWYISU-UHFFFAOYSA-N |
| SMILES | CCN(c1ccccc1)c1ccccc1[N+](=O)[O-] |
|
~%
N-ethyl-2-nitro... CAS#:43199-97-9 |
| Literature: Storrie; Tucker Journal of the Chemical Society, 1931 , p. 2255,2262 |
| N-Ethyl-2-nitro-diphenylamin |
| Benzenamine,N-ethyl-2-nitro-N-phenyl |
| N-Ethyl-nitro-2-diphenylamin |