deoxycorticosterone 21-glucoside*crystalline structure
|
Common Name | deoxycorticosterone 21-glucoside*crystalline | ||
|---|---|---|---|---|
| CAS Number | 4319-56-6 | Molecular Weight | 476.60200 | |
| Density | 1.32g/cm3 | Boiling Point | 709ºC at 760 mmHg | |
| Molecular Formula | C27H40O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 234.8ºC | |
| Name | Deoxycorticosterone 21-glucoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 709ºC at 760 mmHg |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.60200 |
| Flash Point | 234.8ºC |
| Exact Mass | 476.27700 |
| PSA | 113.29000 |
| LogP | 2.54770 |
| Index of Refraction | 1.595 |
| InChIKey | SMSMUZPFFJLROV-PKBAJZTPSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(C(=O)COC3OC(CO)C(O)C(O)C3O)CCC12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 3,20-Dioxopregn-4-en-21-yl 6-deoxyhexopyranoside |