11-deoxycorticosterone-21-hemisuccinate
Modify Date: 2025-10-02 11:12:31
11-deoxycorticosterone-21-hemisuccinate structure
|
Common Name | 11-deoxycorticosterone-21-hemisuccinate | ||
|---|---|---|---|---|
| CAS Number | 10215-74-4 | Molecular Weight | 430.53400 | |
| Density | 1.22g/cm3 | Boiling Point | 613.2ºC at 760mmHg | |
| Molecular Formula | C25H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | 11-deoxycorticosterone-21-hemisuccinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 613.2ºC at 760mmHg |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.53400 |
| Flash Point | 205.7ºC |
| Exact Mass | 430.23600 |
| PSA | 97.74000 |
| LogP | 4.11160 |
| Vapour Pressure | 1.29E-16mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | CYWICJWKZPXJSA-PQWRYPMOSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(C(=O)COC(=O)CCC(=O)O)CCC12 |
| WGK Germany | 3 |
|---|
|
~%
11-deoxycortico... CAS#:10215-74-4 |
| Literature: Journal of Biological Chemistry, , vol. 234, p. 1090,1093 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Deoxycorticosterone 21-hemisuccinate |
| 21-Hydroxypregn-4-ene-3,20-dione 21-(hydrogen succinate) |
| 4-[2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid |
| succinic acid mono-(3,20-dioxo-pregn-4-en-21-yl ester) |
| 21-Hydroxyprogesterone 21-hemisuccinate |
| Bernsteinsaeure-mono-(3,20-dioxo-pregn-4-en-21-ylester) |
| 4-Pregnen-21-ol-3,20-dione 21-hemisuccinate |
| 11-Deoxycorticosterone hydrogen succinate |
| Cortexone 21-hemisuccinate |
| 21-Hydroxy-4-pregnene-3,20-dione 21-hemisuccinate |