3-methyl-N,4-diphenyl-piperazine-1-carbothioamide
Modify Date: 2025-08-25 11:21:59
3-methyl-N,4-diphenyl-piperazine-1-carbothioamide structure
|
Common Name | 3-methyl-N,4-diphenyl-piperazine-1-carbothioamide | ||
|---|---|---|---|---|
| CAS Number | 4318-46-1 | Molecular Weight | 311.44400 | |
| Density | 1.201g/cm3 | Boiling Point | 450.4ºC at 760 mmHg | |
| Molecular Formula | C18H21N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.2ºC | |
| Name | 3-methyl-N,4-diphenylpiperazine-1-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 450.4ºC at 760 mmHg |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.44400 |
| Flash Point | 226.2ºC |
| Exact Mass | 311.14600 |
| PSA | 50.60000 |
| LogP | 3.67000 |
| Index of Refraction | 1.66 |
| InChIKey | YKQGPJJZGWOABL-UHFFFAOYSA-N |
| SMILES | CC1CN(C(=S)Nc2ccccc2)CCN1c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-4-phenyl-piperazin-1-thiocarbonsaeure-anilid |
| 3-methyl-4-phenyl-piperazine-1-carbothioic acid anilide |