1-Piperazinecarbothioamide,4-methyl-N-(4-nitrophenyl)- structure
|
Common Name | 1-Piperazinecarbothioamide,4-methyl-N-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 78721-53-6 | Molecular Weight | 280.34600 | |
| Density | 1.355g/cm3 | Boiling Point | 410.6ºC at 760 mmHg | |
| Molecular Formula | C12H16N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | 4-methyl-N-(4-nitrophenyl)piperazine-1-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 410.6ºC at 760 mmHg |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.34600 |
| Flash Point | 202.1ºC |
| Exact Mass | 280.09900 |
| PSA | 96.42000 |
| LogP | 2.01100 |
| Index of Refraction | 1.676 |
| InChIKey | SXQZCXHNYYVDNL-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=S)Nc2ccc([N+](=O)[O-])cc2)CC1 |
|
~81%
1-Piperazinecar... CAS#:78721-53-6 |
| Literature: Abuzar,Syed; Sharma, Satyavan Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 3 p. 230 - 233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms2190a15 |