4,4'-Diamino-2-methylazobenzene structure
|
Common Name | 4,4'-Diamino-2-methylazobenzene | ||
|---|---|---|---|---|
| CAS Number | 43151-99-1 | Molecular Weight | 226.27700 | |
| Density | 1.21g/cm3 | Boiling Point | 447.7ºC at 760 mmHg | |
| Molecular Formula | C13H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | 4-[(4-aminophenyl)diazenyl]-3-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 447.7ºC at 760 mmHg |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.27700 |
| Flash Point | 224.5ºC |
| Exact Mass | 226.12200 |
| PSA | 76.76000 |
| LogP | 4.73720 |
| Index of Refraction | 1.636 |
| InChIKey | UOABMKNOHFGBSD-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)ccc1N=Nc1ccc(N)cc1 |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R25 |
| Safety Phrases | 22-28-36/37-45-60-61 |
| HS Code | 2927000090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (E)-4-((4-AMINOPHENYL)DIAZENYL)-3-METHYLBENZENAMINE |
| 2-Methyl-4,4'-diaminoazobenzene |
| 4,4'-Diamino-2-methylazobenzene |
| Benzenamine,4-[2-(4-aminophenyl)diazenyl]-3-methyl |
| m-Toluidine,4-[(p-aminophenyl)azo]-(7CI) |
| Benzenamine,4-[(4-aminophenyl)azo]-3-methyl-(9CI) |
| 4-[2-(4-Aminophenyl)Diazenyl]-3-Methyl-Benzenamine |