4-nitroacridine structure
|
Common Name | 4-nitroacridine | ||
|---|---|---|---|---|
| CAS Number | 42955-73-7 | Molecular Weight | 224.21500 | |
| Density | 1.377g/cm3 | Boiling Point | 424.1ºC at 760mmHg | |
| Molecular Formula | C13H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | 4-nitroacridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 424.1ºC at 760mmHg |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.21500 |
| Flash Point | 210.3ºC |
| Exact Mass | 224.05900 |
| PSA | 58.71000 |
| LogP | 3.81940 |
| Index of Refraction | 1.754 |
| InChIKey | VOXJXIMFTHTSAF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2cc3ccccc3nc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-nitro-acridine |
| Acridine,4-nitro |
| 4-Nitro-acridin |