N-(3-Acetylphenyl)-2-chloroacetamide
Modify Date: 2025-09-02 21:26:41
N-(3-Acetylphenyl)-2-chloroacetamide structure
|
Common Name | N-(3-Acetylphenyl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 42865-69-0 | Molecular Weight | 211.64500 | |
| Density | 1.279g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | N-(3-Acetylphenyl)-2-chloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.64500 |
| Flash Point | 203.5ºC |
| Exact Mass | 211.04000 |
| PSA | 46.17000 |
| LogP | 2.13950 |
| Index of Refraction | 1.584 |
| InChIKey | HLFQTKCUEGIERF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(NC(=O)CCl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-Acetylphen... CAS#:42865-69-0 |
| Literature: Jacobs; Heidelberger Journal of Biological Chemistry, 1915 , vol. 21, p. 150 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:56974-53-9| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Chloracetamino-acetophenon |
| 3-Chloracetylamino-acetophenon |
| N-Chloracetyl-m-acetyl-anilin |
| F9995-0365 |