N-(3-acetylphenyl)-2-methyl-3-nitrobenzamide structure
|
Common Name | N-(3-acetylphenyl)-2-methyl-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 314023-58-0 | Molecular Weight | 298.29300 | |
| Density | 1.308g/cm3 | Boiling Point | 412.1ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203ºC | |
| Name | N-(3-acetylphenyl)-2-methyl-3-nitrobenzamide |
|---|
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 412.1ºC at 760 mmHg |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.29300 |
| Flash Point | 203ºC |
| Exact Mass | 298.09500 |
| PSA | 91.99000 |
| LogP | 3.95430 |
| Index of Refraction | 1.64 |
| InChIKey | ICMYWIRGHHRUNS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(NC(=O)c2cccc([N+](=O)[O-])c2C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |