Pyridine, 2,2-dithiobis[3-nitro-
Modify Date: 2025-09-12 22:45:57
Pyridine, 2,2-dithiobis[3-nitro- structure
|
Common Name | Pyridine, 2,2-dithiobis[3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 4282-19-3 | Molecular Weight | 310.30900 | |
| Density | 1.65g/cm3 | Boiling Point | 473.3ºC at 760 mmHg | |
| Molecular Formula | C10H6N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240ºC | |
| Name | 3-nitro-2-[(3-nitropyridin-2-yl)disulfanyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 473.3ºC at 760 mmHg |
| Molecular Formula | C10H6N4O4S2 |
| Molecular Weight | 310.30900 |
| Flash Point | 240ºC |
| Exact Mass | 309.98300 |
| PSA | 168.02000 |
| LogP | 4.13880 |
| Index of Refraction | 1.733 |
| InChIKey | QHSXWDVVFHXHHB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccnc1SSc1ncccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,3'-dinitro-2,2'-dithiodipyridine |
| 3,3'-dinitro-2,2'-dipyridyl disulfide |
| 3,3'-dinitro-2,2'-disulfanediyl-bis-pyridine |